Skip to content

Token Samplers

TokenSamplers are the objects that propose new tokens during generation. They generate individual tokens \(x\) given a context sequence. Each sample \(x\) is attached with a log importance weight \(w\).1

Direct Token Sampling

The simplest token sampler is the DirectTokenSampler, which samples directly from the normalized version of a potential's logw_next method:

# Create a direct token sampler for a potential
sampler = DirectTokenSampler(potential)

# Sample a token
token, logw, logp = await sampler.sample(context)

DirectTokenSampler is efficient when the potential's logw_next method is efficient (e.g., for language models). However, for potentials with large vocabularies or expensive logw_next computations, other sampling strategies may be more appropriate.

Sampling from arbitrary proposals

Both DirectTokenSampler and AWRS accept an optional proposal potential. When supplied, the sampler draws candidate tokens from proposal.logw_next and applies a per-step importance correction so the returned (token, weight) remains properly weighted with respect to the target's logw_next. With proposal=None (the default), each sampler is its own proposal.

A typical use case is pairing a larger target LM with a smaller proposal LM that shares the same tokenizer. Below we use Llama-3.2-3B as the target and Llama-3.2-1B as the proposal for molecular synthesis. The task (taken from genlm-eval) is to generate a valid SMILES string conditioned on a few example molecules:

from genlm.control import PromptedLLM, direct_token_sampler
from genlm.eval.domains.molecular_synthesis import (
    PartialSMILES, default_prompt_formatter, MolecularSynthesisInstance,
)

# Llama-3.2-1B and -3B share the same tokenizer, so their vocab_eos matches.
target = PromptedLLM.from_name("meta-llama/Llama-3.2-3B")
proposal = PromptedLLM.from_name("meta-llama/Llama-3.2-1B")

instance = MolecularSynthesisInstance(
    instance_id=0,
    molecules=["BrC1=C2C3C4C3N(CC4C#C)C2=NC(=O)S1"],
)
prompt_ids = default_prompt_formatter(target.model.tokenizer, instance)
target.prompt_ids = prompt_ids
proposal.prompt_ids = prompt_ids

# Byte-level SMILES validity, coerced onto the LM's token vocabulary.
smiles_critic = PartialSMILES().coerce(target, f=b"".join)

sampler = direct_token_sampler(target, proposal=proposal)
sequences = await sampler.smc(
    n_particles=10, ess_threshold=0.5, max_tokens=40, critic=smiles_critic,
)

The same proposal= argument is available on AWRS when the constraint is boolean:

sampler = AWRS(target, smiles_critic, proposal=proposal)

Other use cases include the same LM at a different temperature (e.g., a flatter proposal that explores more broadly), or the same LM under a different prompt (e.g., a more permissive instruction as the proposal).

Requirements: The proposal must share the target's vocab_eos (same tokenizer). Cross-tokenizer proposals raise ValueError.

Adaptive Weighted Rejection Sampling

When attempting to sample from the product of a potential (e.g., a language model) and a boolean constraint potential (e.g., a CFG or JSON schema potential), the most efficient and lowest variance sampler is AWRS.2 This framework is described in detail in Lipkin et al. (2025).

# Create a AWRS token sampler from an llm and a cfg
token_sampler = AWRS(llm, cfg)
# Sample a token and weight
token, logw, _ = await token_sampler.sample(context)

Set-based Token Sampling

A SetTokenSampler samples tokens by first sampling a weighted subset of tokens using a SetSampler, and then selects one token from the set proportional to its weight. These samplers are commonly used to sample tokens from a language model while enforcing non-boolean byte-level constraints. This algorithm is described in Appendix C of Loula et al. (2025).

Set Samplers

SetTokenSamplers wrap a SetSampler, which is responsible for sampling a weighted subset of tokens. Currently, genlm-control provides two set samplers:

  1. EagerSetSampler - Eagerly samples a set of tokens by sampling one "subtoken" (e.g., byte) at a time.
  2. TopKSetSampler - Lazily enumerates the top \(K\) tokens by weight and samples an additional "wildcard" token to ensure absolute continuity. This sampler is typically slower than EagerSetSampler.

Both of these set samplers are designed to work with two types of potentials:

  1. An iterable potential which has a vocabulary of iterable tokens (e.g., over byte sequences)
  2. An item potential which has a vocabulary of items which form the elements of iterable tokens (e.g., over individual bytes)

In common scenarios, the iterable potential is a language model and the item potential is a byte-level potential.

# Create a set-based token sampler using a set sampler
set_sampler = EagerSetSampler(llm, fsa)
token_sampler = SetTokenSampler(set_sampler)

# Sample a token and weight
token, logw, _ = await token_sampler.sample(context)

Factory methods

For convenience, we provide factory methods for creating set token samplers from potentials.

from genlm.control.sampler import topk_token_sampler, eager_token_sampler

topk_sampler = topk_token_sampler(llm, fsa, K=10)

eager_sampler = eager_token_sampler(llm, fsa)

Sampler Selection Guide for Controlled Generation

The following table provides general guidelines for selecting a sampler in the context of controlled generation from an LLM. Note that the best sampler may vary depending on the specific controlled generation task.

Scenario Recommended Sampler Notes
No token-level constraints DirectTokenSampler Basic LM sampling; used when all constraints are enforced using critics
Boolean constraints (e.g., FSA, CFG, JSON schema) AWRS Efficient, low-variance, and exact sampling from product of a LLM and constraint
Byte-level non-boolean constraints eager_token_sampler Generally less efficient than AWRS, but more flexible

Custom Token Samplers

It is also possible to implement custom token samplers by subclassing the TokenSampler class and implementing the sample method. These implementations must satisfy the following contract.

Token Sampler Contract

All token samplers in genlm-control must generate properly weighted samples with respect to a target potential's next-token weights \(\pot(\cdot \mid \bm{x})\) given a context \(\xx\):

A weighted sample \((x, w) \sim q(\cdot \mid \xx)\) is properly weighted with respect to \(\pot(\cdot \mid \xx)\) if, for any function \(f\),

\[ \mathbb{E}_{(x,w) \sim q(\cdot \mid \xx)}[w f(x)] = \sum_{x \in \A \cup \{\eos\}} f(x)\cdot\pot(x \mid \xx) \]

where \(\mathcal{A}\) is the vocabulary of the target potenital \(\pot\).


  1. Tokens samplers also return a log-probability which corresponds to the log-probability of all the random choices made by the sampler. It is returned for testing purposes and is not used during generation. 

  2. "Higher variance" refers to the variance of the estimator, which is influenced by the variance of the importance weights. When a sampler has high variance, the importance weights can vary dramatically across different samples, leading to unstable estimates in downstream tasks. While high-variance samplers may generate samples efficiently, they often require more samples to achieve the same level of accuracy as lower-variance alternatives.